C14H22N3O4S+ — CID 7364113
ethyl N-[4-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]carbamate (PubChem CID 7364113) has the molecular formula C14H22N3O4S+ and a molecular weight of 328.41 g/mol. Its IUPAC name is ethyl N-[4-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]carbamate.
| Compound Name | ethyl N-[4-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]carbamate |
|---|---|
| PubChem CID | 7364113 |
| Molecular Formula | C14H22N3O4S+ |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | ethyl N-[4-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(S(=O)(=O)N2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C14H21N3O4S/c1-3-21-14(18)15-12-4-6-13(7-5-12)22(19,20)17-10-8-16(2)9-11-17/h4-7H,3,8-11H2,1-2H3,(H,15,18)/p+1 |
| InChIKey | DIWIINVZCQCQMG-UHFFFAOYSA-O |
| XLogP | -0.23 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |