C18H28N3O6S+ — CID 9081700
ethyl 4-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylanilino]-4-oxobutanoate (PubChem CID 9081700) has the molecular formula C18H28N3O6S+ and a molecular weight of 414.50 g/mol. Its IUPAC name is ethyl 4-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylanilino]-4-oxobutanoate.
| Compound Name | ethyl 4-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylanilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 9081700 |
| Molecular Formula | C18H28N3O6S+ |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | ethyl 4-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylanilino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1cc(S(=O)(=O)N2CC[NH+](C)CC2)ccc1OC |
| InChI | InChI=1S/C18H27N3O6S/c1-4-27-18(23)8-7-17(22)19-15-13-14(5-6-16(15)26-3)28(24,25)21-11-9-20(2)10-12-21/h5-6,13H,4,7-12H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | CPHKLVAIWPFTCL-UHFFFAOYSA-O |
| XLogP | -0.50 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |