C21H28N3O4S+ — CID 9081697
N-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]-2-(2-methylphenyl)acetamide (PubChem CID 9081697) has the molecular formula C21H28N3O4S+ and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]-2-(2-methylphenyl)acetamide.
| Compound Name | N-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9081697 |
| Molecular Formula | C21H28N3O4S+ |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]-2-(2-methylphenyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC[NH+](C)CC2)cc1NC(=O)Cc1ccccc1C |
| InChI | InChI=1S/C21H27N3O4S/c1-16-6-4-5-7-17(16)14-21(25)22-19-15-18(8-9-20(19)28-3)29(26,27)24-12-10-23(2)11-13-24/h4-9,15H,10-14H2,1-3H3,(H,22,25)/p+1 |
| InChIKey | NJLVITNDXAPUTN-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |