C16H13BO3 — CID 58403991
(E)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-1-phenylprop-2-en-1-one (PubChem CID 58403991) has the molecular formula C16H13BO3 and a molecular weight of 264.09 g/mol. Its IUPAC name is (E)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 58403991 |
| Molecular Formula | C16H13BO3 |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (E)-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc2c1B(O)OC2)c1ccccc1 |
| InChI | InChI=1S/C16H13BO3/c18-15(12-5-2-1-3-6-12)10-9-13-7-4-8-14-11-20-17(19)16(13)14/h1-10,19H,11H2/b10-9+ |
| InChIKey | NTLCNDOBOCIIOH-MDZDMXLPSA-N |
| XLogP | 1.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|