C16H13NO3 — CID 146468903
(E)-3-(6-amino-1,3-benzodioxol-5-yl)-1-phenylprop-2-en-1-one (PubChem CID 146468903) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is (E)-3-(6-amino-1,3-benzodioxol-5-yl)-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-(6-amino-1,3-benzodioxol-5-yl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 146468903 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (E)-3-(6-amino-1,3-benzodioxol-5-yl)-1-phenylprop-2-en-1-one |
| SMILES | Nc1cc2c(cc1/C=C/C(=O)c1ccccc1)OCO2 |
| InChI | InChI=1S/C16H13NO3/c17-13-9-16-15(19-10-20-16)8-12(13)6-7-14(18)11-4-2-1-3-5-11/h1-9H,10,17H2/b7-6+ |
| InChIKey | UAYBZTKEBRDQIG-VOTSOKGWSA-N |
| XLogP | 2.89 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|