C17H15NO3 — CID 6111236
(E)-3-(1,3-benzodioxol-5-ylmethylamino)-1-phenylprop-2-en-1-one (PubChem CID 6111236) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-ylmethylamino)-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-ylmethylamino)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6111236 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-ylmethylamino)-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/NCc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C17H15NO3/c19-15(14-4-2-1-3-5-14)8-9-18-11-13-6-7-16-17(10-13)21-12-20-16/h1-10,18H,11-12H2/b9-8+ |
| InChIKey | ABOJWHXYBRTNMZ-CMDGGOBGSA-N |
| XLogP | 2.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|