C23H20N2O3 — CID 155819078
(Z)-3-[(4-aminophenyl)methylamino]-3-(1,3-benzodioxol-5-yl)-1-phenylprop-2-en-1-one (PubChem CID 155819078) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is (Z)-3-[(4-aminophenyl)methylamino]-3-(1,3-benzodioxol-5-yl)-1-phenylprop-2-en-1-one.
| Compound Name | (Z)-3-[(4-aminophenyl)methylamino]-3-(1,3-benzodioxol-5-yl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 155819078 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (Z)-3-[(4-aminophenyl)methylamino]-3-(1,3-benzodioxol-5-yl)-1-phenylprop-2-en-1-one |
| SMILES | Nc1ccc(CN/C(=C\C(=O)c2ccccc2)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C23H20N2O3/c24-19-9-6-16(7-10-19)14-25-20(13-21(26)17-4-2-1-3-5-17)18-8-11-22-23(12-18)28-15-27-22/h1-13,25H,14-15,24H2/b20-13- |
| InChIKey | AOVKXAKQROFJDR-MOSHPQCFSA-N |
| XLogP | 4.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|