C21H17NO4 — CID 5425994
(E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(furan-2-yl)-2-phenylprop-2-enamide (PubChem CID 5425994) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(furan-2-yl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(furan-2-yl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 5425994 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(furan-2-yl)-2-phenylprop-2-enamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)/C(=C/c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C21H17NO4/c23-21(22-13-15-8-9-19-20(11-15)26-14-25-19)18(12-17-7-4-10-24-17)16-5-2-1-3-6-16/h1-12H,13-14H2,(H,22,23)/b18-12+ |
| InChIKey | OMGDCBJZMIVNNM-LDADJPATSA-N |
| XLogP | 3.87 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|