C21H16F3NO2 — CID 100735360
(E)-3-(furan-2-yl)-2-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide (PubChem CID 100735360) has the molecular formula C21H16F3NO2 and a molecular weight of 371.36 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-2-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-2-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 100735360 |
| Molecular Formula | C21H16F3NO2 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (E)-3-(furan-2-yl)-2-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)/C(=C/c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C21H16F3NO2/c22-21(23,24)17-9-4-6-15(12-17)14-25-20(26)19(13-18-10-5-11-27-18)16-7-2-1-3-8-16/h1-13H,14H2,(H,25,26)/b19-13+ |
| InChIKey | KIQZKJKAXONYNV-CPNJWEJPSA-N |
| XLogP | 5.16 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|