C17H19BN2O5 — CID 153183520
4-hydroxy-1-[5-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]pentan-1-one (PubChem CID 153183520) has the molecular formula C17H19BN2O5 and a molecular weight of 342.16 g/mol. Its IUPAC name is 4-hydroxy-1-[5-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]pentan-1-one.
| Compound Name | 4-hydroxy-1-[5-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 153183520 |
| Molecular Formula | C17H19BN2O5 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-hydroxy-1-[5-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]pentan-1-one |
| SMILES | Cc1c(Oc2cnc(C(=O)CCC(C)O)cn2)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C17H19BN2O5/c1-10(21)3-5-14(22)13-7-20-16(8-19-13)25-15-6-4-12-9-24-18(23)17(12)11(15)2/h4,6-8,10,21,23H,3,5,9H2,1-2H3 |
| InChIKey | WGQAAYAIXWKUBU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|