C17H19BO4 — CID 90462457
1-hydroxy-6-phenylmethoxy-7-propan-2-yloxy-3H-2,1-benzoxaborole (PubChem CID 90462457) has the molecular formula C17H19BO4 and a molecular weight of 298.15 g/mol. Its IUPAC name is 1-hydroxy-6-phenylmethoxy-7-propan-2-yloxy-3H-2,1-benzoxaborole.
| Compound Name | 1-hydroxy-6-phenylmethoxy-7-propan-2-yloxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 90462457 |
| Molecular Formula | C17H19BO4 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-hydroxy-6-phenylmethoxy-7-propan-2-yloxy-3H-2,1-benzoxaborole |
| SMILES | CC(C)Oc1c(OCc2ccccc2)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C17H19BO4/c1-12(2)22-17-15(20-10-13-6-4-3-5-7-13)9-8-14-11-21-18(19)16(14)17/h3-9,12,19H,10-11H2,1-2H3 |
| InChIKey | XKAWGOGTCVFROD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|