C17H19BN2O5 — CID 122178921
3-methylbutyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate (PubChem CID 122178921) has the molecular formula C17H19BN2O5 and a molecular weight of 342.16 g/mol. Its IUPAC name is 3-methylbutyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate.
| Compound Name | 3-methylbutyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 122178921 |
| Molecular Formula | C17H19BN2O5 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-methylbutyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate |
| SMILES | CC(C)CCOC(=O)c1cnc(Oc2ccc3c(c2)B(O)OC3)cn1 |
| InChI | InChI=1S/C17H19BN2O5/c1-11(2)5-6-23-17(21)15-8-20-16(9-19-15)25-13-4-3-12-10-24-18(22)14(12)7-13/h3-4,7-9,11,22H,5-6,10H2,1-2H3 |
| InChIKey | QAARTSSBRCBLGD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|