C12H9BN2O4 — CID 170992544
5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbaldehyde (PubChem CID 170992544) has the molecular formula C12H9BN2O4 and a molecular weight of 256.03 g/mol. Its IUPAC name is 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbaldehyde.
| Compound Name | 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 170992544 |
| Molecular Formula | C12H9BN2O4 |
| Molecular Weight | 256.03 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbaldehyde |
| SMILES | O=Cc1cnc(Oc2ccc3c(c2)B(O)OC3)cn1 |
| InChI | InChI=1S/C12H9BN2O4/c16-6-9-4-15-12(5-14-9)19-10-2-1-8-7-18-13(17)11(8)3-10/h1-6,17H,7H2 |
| InChIKey | CZBCFMFICZCDGT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.03 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|