C16H17BN2O5 — CID 146895952
4-hydroxy-1-[5-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]butan-1-one (PubChem CID 146895952) has the molecular formula C16H17BN2O5 and a molecular weight of 328.13 g/mol. Its IUPAC name is 4-hydroxy-1-[5-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]butan-1-one.
| Compound Name | 4-hydroxy-1-[5-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]butan-1-one |
|---|---|
| PubChem CID | 146895952 |
| Molecular Formula | C16H17BN2O5 |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-hydroxy-1-[5-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]butan-1-one |
| SMILES | Cc1c(Oc2cnc(C(=O)CCCO)cn2)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C16H17BN2O5/c1-10-14(5-4-11-9-23-17(22)16(10)11)24-15-8-18-12(7-19-15)13(21)3-2-6-20/h4-5,7-8,20,22H,2-3,6,9H2,1H3 |
| InChIKey | UBMNANSAUWVBOU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|