C10H9BO4 — CID 123431450
7-ethenyl-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylic acid (PubChem CID 123431450) has the molecular formula C10H9BO4 and a molecular weight of 203.99 g/mol. Its IUPAC name is 7-ethenyl-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylic acid.
| Compound Name | 7-ethenyl-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylic acid |
|---|---|
| PubChem CID | 123431450 |
| Molecular Formula | C10H9BO4 |
| Molecular Weight | 203.99 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 7-ethenyl-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylic acid |
| SMILES | C=Cc1c(C(=O)O)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C10H9BO4/c1-2-7-8(10(12)13)4-3-6-5-15-11(14)9(6)7/h2-4,14H,1,5H2,(H,12,13) |
| InChIKey | NXLXDAHCFQFJPQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.99 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|