C17H36O — CID 144844935
3,5-dimethylcyclohex-2-en-1-one;ethane;pentane (PubChem CID 144844935) has the molecular formula C17H36O and a molecular weight of 256.47 g/mol. Its IUPAC name is 3,5-dimethylcyclohex-2-en-1-one;ethane;pentane.
| Compound Name | 3,5-dimethylcyclohex-2-en-1-one;ethane;pentane |
|---|---|
| PubChem CID | 144844935 |
| Molecular Formula | C17H36O |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 256.28 |
| IUPAC Name | 3,5-dimethylcyclohex-2-en-1-one;ethane;pentane |
| SMILES | CC.CC.CC1=CC(=O)CC(C)C1.CCCCC |
| InChI | InChI=1S/C8H12O.C5H12.2C2H6/c1-6-3-7(2)5-8(9)4-6;1-3-5-4-2;2*1-2/h4,7H,3,5H2,1-2H3;3-5H2,1-2H3;2*1-2H3 |
| InChIKey | QXCSVBATNGKZMQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |