C11H23NO — CID 99994491
(2S,4S)-4-butoxy-2-propan-2-ylpyrrolidine (PubChem CID 99994491) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is (2S,4S)-4-butoxy-2-propan-2-ylpyrrolidine.
| Compound Name | (2S,4S)-4-butoxy-2-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 99994491 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (2S,4S)-4-butoxy-2-propan-2-ylpyrrolidine |
| SMILES | CCCCO[C@@H]1CN[C@H](C(C)C)C1 |
| InChI | InChI=1S/C11H23NO/c1-4-5-6-13-10-7-11(9(2)3)12-8-10/h9-12H,4-8H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | JUMFSQOGSNWFSI-QWRGUYRKSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|