C17H36ClNO2 — CID 155531918
[(2R,4S)-4-dodecoxypyrrolidin-2-yl]methanol;hydrochloride (PubChem CID 155531918) has the molecular formula C17H36ClNO2 and a molecular weight of 321.93 g/mol. Its IUPAC name is [(2R,4S)-4-dodecoxypyrrolidin-2-yl]methanol;hydrochloride.
| Compound Name | [(2R,4S)-4-dodecoxypyrrolidin-2-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 155531918 |
| Molecular Formula | C17H36ClNO2 |
| Molecular Weight | 321.93 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | [(2R,4S)-4-dodecoxypyrrolidin-2-yl]methanol;hydrochloride |
| SMILES | CCCCCCCCCCCCO[C@@H]1CN[C@@H](CO)C1.Cl |
| InChI | InChI=1S/C17H35NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-20-17-13-16(15-19)18-14-17;/h16-19H,2-15H2,1H3;1H/t16-,17+;/m1./s1 |
| InChIKey | ULZLGZIJXIXKFH-PPPUBMIESA-N |
| XLogP | 4.07 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.93 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|