C13H26O3 — CID 2311827
(2S,5R)-2,5-dibutoxyoxane (PubChem CID 2311827) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is (2S,5R)-2,5-dibutoxyoxane.
| Compound Name | (2S,5R)-2,5-dibutoxyoxane |
|---|---|
| PubChem CID | 2311827 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | (2S,5R)-2,5-dibutoxyoxane |
| SMILES | CCCCO[C@@H]1CC[C@@H](OCCCC)OC1 |
| InChI | InChI=1S/C13H26O3/c1-3-5-9-14-12-7-8-13(16-11-12)15-10-6-4-2/h12-13H,3-11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | TWWXCLBSIXLPEP-OLZOCXBDSA-N |
| XLogP | 3.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|