C12H24O2 — CID 11264119
(2S,4R)-2-butoxy-4-butyloxolane (PubChem CID 11264119) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (2S,4R)-2-butoxy-4-butyloxolane.
| Compound Name | (2S,4R)-2-butoxy-4-butyloxolane |
|---|---|
| PubChem CID | 11264119 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (2S,4R)-2-butoxy-4-butyloxolane |
| SMILES | CCCCO[C@@H]1C[C@@H](CCCC)CO1 |
| InChI | InChI=1S/C12H24O2/c1-3-5-7-11-9-12(14-10-11)13-8-6-4-2/h11-12H,3-10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | ZKMDWYZWEPIAJH-NEPJUHHUSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|