C12H24O2 — CID 15416031
(2S,4R)-4-butyl-2-[(2-methylpropan-2-yl)oxy]oxolane (PubChem CID 15416031) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (2S,4R)-4-butyl-2-[(2-methylpropan-2-yl)oxy]oxolane.
| Compound Name | (2S,4R)-4-butyl-2-[(2-methylpropan-2-yl)oxy]oxolane |
|---|---|
| PubChem CID | 15416031 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (2S,4R)-4-butyl-2-[(2-methylpropan-2-yl)oxy]oxolane |
| SMILES | CCCC[C@H]1CO[C@@H](OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H24O2/c1-5-6-7-10-8-11(13-9-10)14-12(2,3)4/h10-11H,5-9H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | PVWBICOAHKHSPA-MNOVXSKESA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |