C15H26O6 — CID 22378551
diethyl 2-(5-butyl-1,3-dioxan-2-yl)propanedioate (PubChem CID 22378551) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is diethyl 2-(5-butyl-1,3-dioxan-2-yl)propanedioate.
| Compound Name | diethyl 2-(5-butyl-1,3-dioxan-2-yl)propanedioate |
|---|---|
| PubChem CID | 22378551 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | diethyl 2-(5-butyl-1,3-dioxan-2-yl)propanedioate |
| SMILES | CCCCC1COC(C(C(=O)OCC)C(=O)OCC)OC1 |
| InChI | InChI=1S/C15H26O6/c1-4-7-8-11-9-20-15(21-10-11)12(13(16)18-5-2)14(17)19-6-3/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | IAIKNCVUQYRWDH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|