C21H30O6 — CID 54118062
3-acetyloxybutan-2-yl 4-(5-butyl-1,3-dioxan-2-yl)benzoate (PubChem CID 54118062) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is 3-acetyloxybutan-2-yl 4-(5-butyl-1,3-dioxan-2-yl)benzoate.
| Compound Name | 3-acetyloxybutan-2-yl 4-(5-butyl-1,3-dioxan-2-yl)benzoate |
|---|---|
| PubChem CID | 54118062 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 3-acetyloxybutan-2-yl 4-(5-butyl-1,3-dioxan-2-yl)benzoate |
| SMILES | CCCCC1COC(c2ccc(C(=O)OC(C)C(C)OC(C)=O)cc2)OC1 |
| InChI | InChI=1S/C21H30O6/c1-5-6-7-17-12-24-21(25-13-17)19-10-8-18(9-11-19)20(23)27-15(3)14(2)26-16(4)22/h8-11,14-15,17,21H,5-7,12-13H2,1-4H3 |
| InChIKey | NLSTWCYYWSPOSP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |