C23H23FO5 — CID 59695759
(4-prop-2-enoylphenyl) 4-[5-(3-fluoropropyl)-1,3-dioxan-2-yl]benzoate (PubChem CID 59695759) has the molecular formula C23H23FO5 and a molecular weight of 398.43 g/mol. Its IUPAC name is (4-prop-2-enoylphenyl) 4-[5-(3-fluoropropyl)-1,3-dioxan-2-yl]benzoate.
| Compound Name | (4-prop-2-enoylphenyl) 4-[5-(3-fluoropropyl)-1,3-dioxan-2-yl]benzoate |
|---|---|
| PubChem CID | 59695759 |
| Molecular Formula | C23H23FO5 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (4-prop-2-enoylphenyl) 4-[5-(3-fluoropropyl)-1,3-dioxan-2-yl]benzoate |
| SMILES | C=CC(=O)c1ccc(OC(=O)c2ccc(C3OCC(CCCF)CO3)cc2)cc1 |
| InChI | InChI=1S/C23H23FO5/c1-2-21(25)17-9-11-20(12-10-17)29-22(26)18-5-7-19(8-6-18)23-27-14-16(15-28-23)4-3-13-24/h2,5-12,16,23H,1,3-4,13-15H2 |
| InChIKey | ODFAWOWCWAKSNS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|