C11H10O4 — CID 122683290
[4-(1,3-dioxetan-2-yl)phenyl] prop-2-enoate (PubChem CID 122683290) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is [4-(1,3-dioxetan-2-yl)phenyl] prop-2-enoate.
| Compound Name | [4-(1,3-dioxetan-2-yl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 122683290 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | [4-(1,3-dioxetan-2-yl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C2OCO2)cc1 |
| InChI | InChI=1S/C11H10O4/c1-2-10(12)15-9-5-3-8(4-6-9)11-13-7-14-11/h2-6,11H,1,7H2 |
| InChIKey | YFRRZLGHOBQEQL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|