C22H20FNO4 — CID 19938023
(4-cyano-3-fluorophenyl) 4-(5-but-3-enyl-1,3-dioxan-2-yl)benzoate (PubChem CID 19938023) has the molecular formula C22H20FNO4 and a molecular weight of 381.40 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-(5-but-3-enyl-1,3-dioxan-2-yl)benzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 4-(5-but-3-enyl-1,3-dioxan-2-yl)benzoate |
|---|---|
| PubChem CID | 19938023 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-(5-but-3-enyl-1,3-dioxan-2-yl)benzoate |
| SMILES | C=CCCC1COC(c2ccc(C(=O)Oc3ccc(C#N)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C22H20FNO4/c1-2-3-4-15-13-26-22(27-14-15)17-7-5-16(6-8-17)21(25)28-19-10-9-18(12-24)20(23)11-19/h2,5-11,15,22H,1,3-4,13-14H2 |
| InChIKey | JNEGPJMODXSYOG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|