C23H42O5 — CID 139765514
ethyl 2-(3,3-diethoxy-2-octylcyclopentyl)-3-oxobutanoate (PubChem CID 139765514) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is ethyl 2-(3,3-diethoxy-2-octylcyclopentyl)-3-oxobutanoate.
| Compound Name | ethyl 2-(3,3-diethoxy-2-octylcyclopentyl)-3-oxobutanoate |
|---|---|
| PubChem CID | 139765514 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | ethyl 2-(3,3-diethoxy-2-octylcyclopentyl)-3-oxobutanoate |
| SMILES | CCCCCCCCC1C(C(C(C)=O)C(=O)OCC)CCC1(OCC)OCC |
| InChI | InChI=1S/C23H42O5/c1-6-10-11-12-13-14-15-20-19(21(18(5)24)22(25)26-7-2)16-17-23(20,27-8-3)28-9-4/h19-21H,6-17H2,1-5H3 |
| InChIKey | NIXNIFRDQPVBCB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|