C16H28O3 — CID 11777826
ethyl (1R,2R,3R)-2-ethenyl-2-ethoxy-3-hexylcyclopropane-1-carboxylate (PubChem CID 11777826) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is ethyl (1R,2R,3R)-2-ethenyl-2-ethoxy-3-hexylcyclopropane-1-carboxylate.
| Compound Name | ethyl (1R,2R,3R)-2-ethenyl-2-ethoxy-3-hexylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11777826 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | ethyl (1R,2R,3R)-2-ethenyl-2-ethoxy-3-hexylcyclopropane-1-carboxylate |
| SMILES | C=C[C@@]1(OCC)[C@H](CCCCCC)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C16H28O3/c1-5-9-10-11-12-13-14(15(17)18-7-3)16(13,6-2)19-8-4/h6,13-14H,2,5,7-12H2,1,3-4H3/t13-,14+,16-/m1/s1 |
| InChIKey | WTCZOJRKAHIKHM-IJEWVQPXSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|