C18H34O4 — CID 139765521
ethyl 2-(3,3-diethoxy-2-pentylcyclopentyl)acetate (PubChem CID 139765521) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is ethyl 2-(3,3-diethoxy-2-pentylcyclopentyl)acetate.
| Compound Name | ethyl 2-(3,3-diethoxy-2-pentylcyclopentyl)acetate |
|---|---|
| PubChem CID | 139765521 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | ethyl 2-(3,3-diethoxy-2-pentylcyclopentyl)acetate |
| SMILES | CCCCCC1C(CC(=O)OCC)CCC1(OCC)OCC |
| InChI | InChI=1S/C18H34O4/c1-5-9-10-11-16-15(14-17(19)20-6-2)12-13-18(16,21-7-3)22-8-4/h15-16H,5-14H2,1-4H3 |
| InChIKey | HQXZDBBFVFMMCF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|