C17H31NO4 — CID 101077072
ethyl (8R,10R)-8-hexyl-1,5-dioxa-9-azaspiro[5.5]undecane-10-carboxylate (PubChem CID 101077072) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is ethyl (8R,10R)-8-hexyl-1,5-dioxa-9-azaspiro[5.5]undecane-10-carboxylate.
| Compound Name | ethyl (8R,10R)-8-hexyl-1,5-dioxa-9-azaspiro[5.5]undecane-10-carboxylate |
|---|---|
| PubChem CID | 101077072 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | ethyl (8R,10R)-8-hexyl-1,5-dioxa-9-azaspiro[5.5]undecane-10-carboxylate |
| SMILES | CCCCCC[C@@H]1CC2(C[C@H](C(=O)OCC)N1)OCCCO2 |
| InChI | InChI=1S/C17H31NO4/c1-3-5-6-7-9-14-12-17(21-10-8-11-22-17)13-15(18-14)16(19)20-4-2/h14-15,18H,3-13H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | BEMOKWOIQQXBKF-HUUCEWRRSA-N |
| XLogP | 2.77 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|