C19H32F2O4 — CID 20615265
[5-[2-(4-pentylcyclohexyl)ethyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate (PubChem CID 20615265) has the molecular formula C19H32F2O4 and a molecular weight of 362.46 g/mol. Its IUPAC name is [5-[2-(4-pentylcyclohexyl)ethyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate.
| Compound Name | [5-[2-(4-pentylcyclohexyl)ethyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate |
|---|---|
| PubChem CID | 20615265 |
| Molecular Formula | C19H32F2O4 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | [5-[2-(4-pentylcyclohexyl)ethyl]-1,3-dioxan-2-yl] 2,2-difluoroacetate |
| SMILES | CCCCCC1CCC(CCC2COC(OC(=O)C(F)F)OC2)CC1 |
| InChI | InChI=1S/C19H32F2O4/c1-2-3-4-5-14-6-8-15(9-7-14)10-11-16-12-23-19(24-13-16)25-18(22)17(20)21/h14-17,19H,2-13H2,1H3 |
| InChIKey | XIQBVXJBJQSKJG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|