C10H18O7 — CID 177164369
(2R,3R,5S)-2-[(2R,3R,5S)-3,5-dihydroxyoxan-2-yl]oxyoxane-3,5-diol (PubChem CID 177164369) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is (2R,3R,5S)-2-[(2R,3R,5S)-3,5-dihydroxyoxan-2-yl]oxyoxane-3,5-diol.
| Compound Name | (2R,3R,5S)-2-[(2R,3R,5S)-3,5-dihydroxyoxan-2-yl]oxyoxane-3,5-diol |
|---|---|
| PubChem CID | 177164369 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2R,3R,5S)-2-[(2R,3R,5S)-3,5-dihydroxyoxan-2-yl]oxyoxane-3,5-diol |
| SMILES | O[C@@H]1CO[C@H](O[C@H]2OC[C@@H](O)C[C@H]2O)[C@H](O)C1 |
| InChI | InChI=1S/C10H18O7/c11-5-1-7(13)9(15-3-5)17-10-8(14)2-6(12)4-16-10/h5-14H,1-4H2/t5-,6-,7+,8+,9+,10+/m0/s1 |
| InChIKey | BPWKHYRDHJRCAX-HQBQHRAMSA-N |
| XLogP | -2.06 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |