C19H20O6 — CID 142608640
(2S,5S)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]oxane-3,5-diol (PubChem CID 142608640) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (2S,5S)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]oxane-3,5-diol.
| Compound Name | (2S,5S)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]oxane-3,5-diol |
|---|---|
| PubChem CID | 142608640 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2S,5S)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]oxane-3,5-diol |
| SMILES | Oc1cc(O)cc(/C=C/c2ccc(O[C@@H]3OC[C@@H](O)CC3O)cc2)c1 |
| InChI | InChI=1S/C19H20O6/c20-14-7-13(8-15(21)9-14)2-1-12-3-5-17(6-4-12)25-19-18(23)10-16(22)11-24-19/h1-9,16,18-23H,10-11H2/b2-1+/t16-,18?,19-/m0/s1 |
| InChIKey | DXJDTFKRLCRYJV-MUHZZFAOSA-N |
| XLogP | 2.12 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|