C4H11N3O2 — CID 163447775
3,4,5-triaminooxolan-2-ol (PubChem CID 163447775) has the molecular formula C4H11N3O2 and a molecular weight of 133.15 g/mol. Its IUPAC name is 3,4,5-triaminooxolan-2-ol.
| Compound Name | 3,4,5-triaminooxolan-2-ol |
|---|---|
| PubChem CID | 163447775 |
| Molecular Formula | C4H11N3O2 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 3,4,5-triaminooxolan-2-ol |
| SMILES | NC1OC(O)C(N)C1N |
| InChI | InChI=1S/C4H11N3O2/c5-1-2(6)4(8)9-3(1)7/h1-4,8H,5-7H2 |
| InChIKey | BDYUURJKFFHBQH-UHFFFAOYSA-N |
| XLogP | -2.73 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |