C7H12O4 — CID 58545377
CID 58545377 (PubChem CID 58545377) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol.
| Compound Name | CID 58545377 |
|---|---|
| PubChem CID | 58545377 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | — |
| SMILES | [CH]C1O[C@@H](C)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H12O4/c1-3-5(8)7(10)6(9)4(2)11-3/h1,3-10H,2H3/t3?,4-,5-,6?,7-/m0/s1 |
| InChIKey | PONJAHKMZMLSSM-VBBXJRDUSA-N |
| XLogP | -1.43 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |