C6H12O4S — CID 22815166
(2S,3S,4R,5S,6R)-2-methyl-6-sulfanyloxane-3,4,5-triol (PubChem CID 22815166) has the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-2-methyl-6-sulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6R)-2-methyl-6-sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 22815166 |
| Molecular Formula | C6H12O4S |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (2S,3S,4R,5S,6R)-2-methyl-6-sulfanyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@H](S)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O4S/c1-2-3(7)4(8)5(9)6(11)10-2/h2-9,11H,1H3/t2-,3+,4+,5-,6+/m0/s1 |
| InChIKey | SGCGFOOGTWZYCQ-SXUWKVJYSA-N |
| XLogP | -1.26 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|