C8H13NO5 — CID 130023825
N-(3,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptan-2-yl)acetamide (PubChem CID 130023825) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is N-(3,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptan-2-yl)acetamide.
| Compound Name | N-(3,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptan-2-yl)acetamide |
|---|---|
| PubChem CID | 130023825 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | N-(3,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptan-2-yl)acetamide |
| SMILES | CC(=O)NC1C(O)C(O)C(O)C2OC12 |
| InChI | InChI=1S/C8H13NO5/c1-2(10)9-3-4(11)5(12)6(13)8-7(3)14-8/h3-8,11-13H,1H3,(H,9,10) |
| InChIKey | KWXPYPFPPWXLLM-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|