C8H13NO4 — CID 58948074
N-(3,4-dihydroxy-7-oxabicyclo[4.1.0]heptan-2-yl)acetamide (PubChem CID 58948074) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is N-(3,4-dihydroxy-7-oxabicyclo[4.1.0]heptan-2-yl)acetamide.
| Compound Name | N-(3,4-dihydroxy-7-oxabicyclo[4.1.0]heptan-2-yl)acetamide |
|---|---|
| PubChem CID | 58948074 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | N-(3,4-dihydroxy-7-oxabicyclo[4.1.0]heptan-2-yl)acetamide |
| SMILES | CC(=O)NC1C(O)C(O)CC2OC21 |
| InChI | InChI=1S/C8H13NO4/c1-3(10)9-6-7(12)4(11)2-5-8(6)13-5/h4-8,11-12H,2H2,1H3,(H,9,10) |
| InChIKey | MKLJQYXXBOMMGG-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|