About pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile
pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile (PubChem CID 15048985) has the molecular formula C10H6N2
and a molecular weight of 154.17 g/mol. Its IUPAC name is pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile.
Analyze pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile?
The IUPAC name of pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile (CID 15048985) is pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile.
What is the SMILES notation for pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile?
The canonical SMILES for pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile is N#CC12C3C1C1C4C(C32)C41C#N.
What is the InChIKey of pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile?
The InChIKey is PUUDWFRQFXNPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2/c11-1-9-3-5(9)7-4-8(6(3)9)10(4,7)2-12/h3-8H.
What are the key properties of pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile?
pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile has a molecular weight of 154.17 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentacyclo[5.1.0.02,4.03,5.06,8]octane-3,7-dicarbonitrile is sourced from PubChem (CID 15048985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).