C13H8N4 — CID 134979367
(1S,7R)-tetracyclo[4.3.0.02,4.03,7]nonane-8,8,9,9-tetracarbonitrile (PubChem CID 134979367) has the molecular formula C13H8N4 and a molecular weight of 220.23 g/mol. Its IUPAC name is (1S,7R)-tetracyclo[4.3.0.02,4.03,7]nonane-8,8,9,9-tetracarbonitrile.
| Compound Name | (1S,7R)-tetracyclo[4.3.0.02,4.03,7]nonane-8,8,9,9-tetracarbonitrile |
|---|---|
| PubChem CID | 134979367 |
| Molecular Formula | C13H8N4 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (1S,7R)-tetracyclo[4.3.0.02,4.03,7]nonane-8,8,9,9-tetracarbonitrile |
| SMILES | N#CC1(C#N)[C@@H]2C3C4CC2[C@H](C43)C1(C#N)C#N |
| InChI | InChI=1S/C13H8N4/c14-2-12(3-15)10-7-1-6-8(10)9(6)11(7)13(12,4-16)5-17/h6-11H,1H2/t6?,7?,8?,9?,10-,11+ |
| InChIKey | GLTWQRWKUMNHFV-YZGMSDOFSA-N |
| XLogP | 1.20 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|