C26H30 — CID 163021174
(3R,5S,7R,9S,10S,12R,16R,18S,20R,22S,23S,25R)-dodecacyclo[12.12.0.01,6.02,23.03,20.05,18.07,16.09,26.010,15.012,25.013,22.014,19]hexacosane (PubChem CID 163021174) has the molecular formula C26H30 and a molecular weight of 342.53 g/mol. Its IUPAC name is (3R,5S,7R,9S,10S,12R,16R,18S,20R,22S,23S,25R)-dodecacyclo[12.12.0.01,6.02,23.03,20.05,18.07,16.09,26.010,15.012,25.013,22.014,19]hexacosane.
| Compound Name | (3R,5S,7R,9S,10S,12R,16R,18S,20R,22S,23S,25R)-dodecacyclo[12.12.0.01,6.02,23.03,20.05,18.07,16.09,26.010,15.012,25.013,22.014,19]hexacosane |
|---|---|
| PubChem CID | 163021174 |
| Molecular Formula | C26H30 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (3R,5S,7R,9S,10S,12R,16R,18S,20R,22S,23S,25R)-dodecacyclo[12.12.0.01,6.02,23.03,20.05,18.07,16.09,26.010,15.012,25.013,22.014,19]hexacosane |
| SMILES | C1[C@@H]2C3[C@@H]4C[C@@H]5C6[C@@H]7C[C@@H]8C9[C@H]1[C@H]1C[C@@H]8C8[C@@H]7C[C@@H]5C5[C@@H]4C[C@@H]2C1C58C936 |
| InChI | InChI=1S/C26H30/c1-7-9-2-13-11-4-15-17-6-18-16-5-12-14-3-10-8(1)20(12)25(19(7)11,22(15)16)26(21(9)10,23(13)17)24(14)18/h7-24H,1-6H2/t7-,8+,9-,10+,11+,12-,13+,14-,15-,16+,17-,18+,19?,20?,21?,22?,23?,24?,25?,26? |
| InChIKey | ZPYAFALRWQDRPH-WVAZPKSISA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |