C18H16I2 — CID 22833797
(1R,2R,3S,6S,7S,8S)-4-iodo-5-[(1R,2S,3S,6R,7S,8S)-5-iodo-4-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl]pentacyclo[4.3.0.02,4.03,8.05,7]nonane (PubChem CID 22833797) has the molecular formula C18H16I2 and a molecular weight of 486.13 g/mol. Its IUPAC name is (1R,2R,3S,6S,7S,8S)-4-iodo-5-[(1R,2S,3S,6R,7S,8S)-5-iodo-4-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl]pentacyclo[4.3.0.02,4.03,8.05,7]nonane.
| Compound Name | (1R,2R,3S,6S,7S,8S)-4-iodo-5-[(1R,2S,3S,6R,7S,8S)-5-iodo-4-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl]pentacyclo[4.3.0.02,4.03,8.05,7]nonane |
|---|---|
| PubChem CID | 22833797 |
| Molecular Formula | C18H16I2 |
| Molecular Weight | 486.13 g/mol |
| Exact Mass | 485.93 |
| IUPAC Name | (1R,2R,3S,6S,7S,8S)-4-iodo-5-[(1R,2S,3S,6R,7S,8S)-5-iodo-4-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl]pentacyclo[4.3.0.02,4.03,8.05,7]nonane |
| SMILES | IC12[C@@H]3[C@@H]4C[C@H]([C@@H]31)[C@H]1[C@H]4C12C12[C@H]3[C@@H]4C[C@@H]([C@@H]5[C@H]4C51I)[C@@H]32 |
| InChI | InChI=1S/C18H16I2/c19-17-11-3-1-4(12(11)17)8-7(3)15(8,17)16-9-5-2-6(10(9)16)14-13(5)18(14,16)20/h3-14H,1-2H2/t3-,4+,5-,6+,7-,8-,9-,10-,11-,12+,13-,14+,15?,16?,17?,18?/m0/s1 |
| InChIKey | XQQCBOTVXBOSIZ-CNVOHJAYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.13 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|