C9H9Cl — CID 10397012
4-chloropentacyclo[4.3.0.02,5.03,8.04,7]nonane (PubChem CID 10397012) has the molecular formula C9H9Cl and a molecular weight of 152.62 g/mol. Its IUPAC name is 4-chloropentacyclo[4.3.0.02,5.03,8.04,7]nonane.
| Compound Name | 4-chloropentacyclo[4.3.0.02,5.03,8.04,7]nonane |
|---|---|
| PubChem CID | 10397012 |
| Molecular Formula | C9H9Cl |
| Molecular Weight | 152.62 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 4-chloropentacyclo[4.3.0.02,5.03,8.04,7]nonane |
| SMILES | ClC12C3C4CC5C3C1C5C42 |
| InChI | InChI=1S/C9H9Cl/c10-9-6-3-1-2-4(6)8(9)5(2)7(3)9/h2-8H,1H2 |
| InChIKey | WBCYVNDSPMRLOQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.62 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|