C14H18O2 — CID 124791229
[(1S,2R,3R,4R,6S,7R,8S,9R,10S,12R)-5-(hydroxymethyl)-5-hexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecanyl]methanol (PubChem CID 124791229) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is [(1S,2R,3R,4R,6S,7R,8S,9R,10S,12R)-5-(hydroxymethyl)-5-hexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecanyl]methanol.
| Compound Name | [(1S,2R,3R,4R,6S,7R,8S,9R,10S,12R)-5-(hydroxymethyl)-5-hexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecanyl]methanol |
|---|---|
| PubChem CID | 124791229 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [(1S,2R,3R,4R,6S,7R,8S,9R,10S,12R)-5-(hydroxymethyl)-5-hexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecanyl]methanol |
| SMILES | OCC1(CO)[C@@H]2[C@@H]3[C@@H]4[C@@H]5C[C@H]6[C@H]4[C@@H]3[C@H]1[C@H]6[C@@H]52 |
| InChI | InChI=1S/C14H18O2/c15-2-14(3-16)12-8-4-1-5-7-6(4)10(12)11(7)13(14)9(5)8/h4-13,15-16H,1-3H2/t4-,5-,6+,7+,8+,9+,10-,11+,12+,13-/m0/s1 |
| InChIKey | GHGDMDGNVDPXJJ-POKBDJNNSA-N |
| XLogP | 0.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |