C7H8ClI — CID 91699610
3-chloro-5-iodotricyclo[2.2.1.02,6]heptane (PubChem CID 91699610) has the molecular formula C7H8ClI and a molecular weight of 254.50 g/mol. Its IUPAC name is 3-chloro-5-iodotricyclo[2.2.1.02,6]heptane.
| Compound Name | 3-chloro-5-iodotricyclo[2.2.1.02,6]heptane |
|---|---|
| PubChem CID | 91699610 |
| Molecular Formula | C7H8ClI |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | 3-chloro-5-iodotricyclo[2.2.1.02,6]heptane |
| SMILES | ClC1C2CC3C1C3C2I |
| InChI | InChI=1S/C7H8ClI/c8-6-3-1-2-4(6)5(2)7(3)9/h2-7H,1H2 |
| InChIKey | DTHZWZZYJVYLPI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|