C13H15I2NO3 — CID 98083989
2-[(1R,2R,3S,5S,6R,7S,8S,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethyl nitrate (PubChem CID 98083989) has the molecular formula C13H15I2NO3 and a molecular weight of 487.08 g/mol. Its IUPAC name is 2-[(1R,2R,3S,5S,6R,7S,8S,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethyl nitrate.
| Compound Name | 2-[(1R,2R,3S,5S,6R,7S,8S,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethyl nitrate |
|---|---|
| PubChem CID | 98083989 |
| Molecular Formula | C13H15I2NO3 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.91 |
| IUPAC Name | 2-[(1R,2R,3S,5S,6R,7S,8S,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethyl nitrate |
| SMILES | O=[N+]([O-])OCC[C@@]12[C@@H]3[C@@H]4C[C@@H]5[C@H]3[C@H](I)[C@H]1[C@@H]5[C@H]4[C@H]2I |
| InChI | InChI=1S/C13H15I2NO3/c14-11-8-4-3-5-7-6(4)10(11)13(9(5)8,12(7)15)1-2-19-16(17)18/h4-12H,1-3H2/t4-,5+,6-,7-,8+,9+,10+,11-,12+,13+/m0/s1 |
| InChIKey | KTJQNBGHXAEKPY-SUTJXBHASA-N |
| XLogP | 2.95 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|