C8H9ClO2 — CID 98141134
(1R,2S,3R,4S,5R,6R)-5-chlorotricyclo[2.2.1.02,6]heptane-3-carboxylic acid (PubChem CID 98141134) has the molecular formula C8H9ClO2 and a molecular weight of 172.61 g/mol. Its IUPAC name is (1R,2S,3R,4S,5R,6R)-5-chlorotricyclo[2.2.1.02,6]heptane-3-carboxylic acid.
| Compound Name | (1R,2S,3R,4S,5R,6R)-5-chlorotricyclo[2.2.1.02,6]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 98141134 |
| Molecular Formula | C8H9ClO2 |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | (1R,2S,3R,4S,5R,6R)-5-chlorotricyclo[2.2.1.02,6]heptane-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@@H]2C[C@H]3[C@@H]([C@@H]2Cl)[C@@H]31 |
| InChI | InChI=1S/C8H9ClO2/c9-7-3-1-2-4(5(2)7)6(3)8(10)11/h2-7H,1H2,(H,10,11)/t2-,3+,4-,5-,6+,7-/m1/s1 |
| InChIKey | CUKQVVIKFMEADY-LXTYMGNCSA-N |
| XLogP | 1.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|