C9H10Br2O4 — CID 124769571
(1R,2R,3S,4R,5S,6S)-5,6-dibromobicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 124769571) has the molecular formula C9H10Br2O4 and a molecular weight of 341.98 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S,6S)-5,6-dibromobicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
| Compound Name | (1R,2R,3S,4R,5S,6S)-5,6-dibromobicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 124769571 |
| Molecular Formula | C9H10Br2O4 |
| Molecular Weight | 341.98 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | (1R,2R,3S,4R,5S,6S)-5,6-dibromobicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2C[C@@H]([C@H](Br)[C@H]2Br)[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H10Br2O4/c10-6-2-1-3(7(6)11)5(9(14)15)4(2)8(12)13/h2-7H,1H2,(H,12,13)(H,14,15)/t2-,3-,4-,5+,6+,7+/m1/s1 |
| InChIKey | HECPLCNVJSYLGU-MAFUWASYSA-N |
| XLogP | 1.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.98 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|