C7H8Cl2O2 — CID 98533360
(1S,2S,3R,4S)-2,3-dichlorobicyclo[2.1.1]hexane-5-carboxylic acid (PubChem CID 98533360) has the molecular formula C7H8Cl2O2 and a molecular weight of 195.04 g/mol. Its IUPAC name is (1S,2S,3R,4S)-2,3-dichlorobicyclo[2.1.1]hexane-5-carboxylic acid.
| Compound Name | (1S,2S,3R,4S)-2,3-dichlorobicyclo[2.1.1]hexane-5-carboxylic acid |
|---|---|
| PubChem CID | 98533360 |
| Molecular Formula | C7H8Cl2O2 |
| Molecular Weight | 195.04 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | (1S,2S,3R,4S)-2,3-dichlorobicyclo[2.1.1]hexane-5-carboxylic acid |
| SMILES | O=C(O)C1[C@@H]2C[C@@H]1[C@@H](Cl)[C@H]2Cl |
| InChI | InChI=1S/C7H8Cl2O2/c8-5-2-1-3(6(5)9)4(2)7(10)11/h2-6H,1H2,(H,10,11)/t2-,3-,4?,5-,6+/m0/s1 |
| InChIKey | MFMXUIWLKSJDHV-CWWYDYSWSA-N |
| XLogP | 1.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.04 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|