3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid

C8H10O5 — CID 140586637

IUPAC3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid
SMILESO=C(O)C1C(O)CC2C(C(=O)O)C21
InChIInChI=1S/C8H10O5/c9-3-1-2-4(5(2)7(10)11)6(3)8(12)13/h2-6,9H,1H2,(H,10,11)(H,12,13)
InChIKeyIWPVVCUKGJTIKG-UHFFFAOYSA-N
MW186.16 g/mol
LogP-0.60
Rot. Bonds2

About 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid

3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 140586637) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid.

Molecular Properties

Compound Name3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid
PubChem CID140586637
Molecular FormulaC8H10O5
Molecular Weight186.16 g/mol
Exact Mass186.05
IUPAC Name3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid
SMILESO=C(O)C1C(O)CC2C(C(=O)O)C21
InChIInChI=1S/C8H10O5/c9-3-1-2-4(5(2)7(10)11)6(3)8(12)13/h2-6,9H,1H2,(H,10,11)(H,12,13)
InChIKeyIWPVVCUKGJTIKG-UHFFFAOYSA-N
XLogP-0.60
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.16
LogP ≤ 5-0.60
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid?
The IUPAC name of 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid (CID 140586637) is 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
What is the SMILES notation for 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid?
The canonical SMILES for 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid is O=C(O)C1C(O)CC2C(C(=O)O)C21.
What is the InChIKey of 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid?
The InChIKey is IWPVVCUKGJTIKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c9-3-1-2-4(5(2)7(10)11)6(3)8(12)13/h2-6,9H,1H2,(H,10,11)(H,12,13).
What are the key properties of 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid?
3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid has a molecular weight of 186.16 g/mol, XLogP of -0.60, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid is sourced from PubChem (CID 140586637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).