C8H10O5 — CID 140586637
3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 140586637) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 140586637 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | O=C(O)C1C(O)CC2C(C(=O)O)C21 |
| InChI | InChI=1S/C8H10O5/c9-3-1-2-4(5(2)7(10)11)6(3)8(12)13/h2-6,9H,1H2,(H,10,11)(H,12,13) |
| InChIKey | IWPVVCUKGJTIKG-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |